C12H8F3NO3S — CID 43417357
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 43417357) has the molecular formula C12H8F3NO3S and a molecular weight of 303.26 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43417357 |
| Molecular Formula | C12H8F3NO3S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CSc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H8F3NO3S/c13-12(14,15)7-1-2-10(16-5-7)20-6-9-8(11(17)18)3-4-19-9/h1-5H,6H2,(H,17,18) |
| InChIKey | SVDBPZSRZCHSEQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |