C8H10BrNO2S — CID 43418201
5-bromo-N-(2-hydroxypropyl)thiophene-3-carboxamide (PubChem CID 43418201) has the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. Its IUPAC name is 5-bromo-N-(2-hydroxypropyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(2-hydroxypropyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43418201 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 5-bromo-N-(2-hydroxypropyl)thiophene-3-carboxamide |
| SMILES | CC(O)CNC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C8H10BrNO2S/c1-5(11)3-10-8(12)6-2-7(9)13-4-6/h2,4-5,11H,3H2,1H3,(H,10,12) |
| InChIKey | FKSXGOPRMGCZDB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |