C11H15NO3 — CID 43418917
N-(1-hydroxypropan-2-yl)-2-phenoxyacetamide (PubChem CID 43418917) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-phenoxyacetamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 43418917 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-phenoxyacetamide |
| SMILES | CC(CO)NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c1-9(7-13)12-11(14)8-15-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,12,14) |
| InChIKey | FGXMJFUNNUHZHT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |