C9H15N3O4 — CID 43419262
N-(3-hydroxypropyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 43419262) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-hydroxypropyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43419262 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(3-hydroxypropyl)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCCCO)C1=O |
| InChI | InChI=1S/C9H15N3O4/c1-11-6-8(15)12(9(11)16)5-7(14)10-3-2-4-13/h13H,2-6H2,1H3,(H,10,14) |
| InChIKey | OXCNYOIYQMDJAF-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|