About N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide
N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 43419307) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 43419307 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(O)CNC(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C8H14N4O2/c1-6(13)3-10-8(14)7(2)12-5-9-4-11-12/h4-7,13H,3H2,1-2H3,(H,10,14) |
| InChIKey | KRFKNZAIGVVWNY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide (CID 43419307) is N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide is CC(O)CNC(=O)C(C)n1cncn1.
What is the InChIKey of N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is KRFKNZAIGVVWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-6(13)3-10-8(14)7(2)12-5-9-4-11-12/h4-7,13H,3H2,1-2H3,(H,10,14).
What are the key properties of N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide?
N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 198.23 g/mol, XLogP of -0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxypropyl)-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 43419307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).