C6H11N5OS — CID 43419443
2-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]ethanol (PubChem CID 43419443) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]ethanol.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 43419443 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]ethanol |
| SMILES | Nc1nc(N)nc(CSCCO)n1 |
| InChI | InChI=1S/C6H11N5OS/c7-5-9-4(3-13-2-1-12)10-6(8)11-5/h12H,1-3H2,(H4,7,8,9,10,11) |
| InChIKey | GWWZCEFXGYEFFW-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|