About N-Acetylprocainamide
N-Acetylprocainamide (PubChem CID 4342) has the molecular formula C15H23N3O2
and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-acetamido-N-[2-(diethylamino)ethyl]benzamide.
Molecular Properties
| Compound Name | N-Acetylprocainamide |
| PubChem CID | 4342 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-acetamido-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)C1=CC=C(C=C1)NC(=O)C |
| InChI | InChI=1S/C15H23N3O2/c1-4-18(5-2)11-10-16-15(20)13-6-8-14(9-7-13)17-12(3)19/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | KEECCEWTUVWFCV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | 308 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-Acetylprocainamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Acetylprocainamide?
The IUPAC name of N-Acetylprocainamide (CID 4342) is 4-acetamido-N-[2-(diethylamino)ethyl]benzamide.
What is the SMILES notation for N-Acetylprocainamide?
The canonical SMILES for N-Acetylprocainamide is CCN(CC)CCNC(=O)C1=CC=C(C=C1)NC(=O)C.
What is the InChIKey of N-Acetylprocainamide?
The InChIKey is KEECCEWTUVWFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-4-18(5-2)11-10-16-15(20)13-6-8-14(9-7-13)17-12(3)19/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H,17,19).
What are the key properties of N-Acetylprocainamide?
N-Acetylprocainamide has a molecular weight of 277.36 g/mol, XLogP of 0.70, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-Acetylprocainamide is sourced from PubChem (CID 4342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).