About N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide
N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 43420939) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| PubChem CID | 43420939 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | CCN(C)C(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-11(2)8(13)6-4-5-7(12)10-9-6/h3-5H2,1-2H3,(H,10,12) |
| InChIKey | FDMXPQXJEPINHF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The IUPAC name of N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (CID 43420939) is N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
What is the SMILES notation for N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The canonical SMILES for N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide is CCN(C)C(=O)C1=NNC(=O)CC1.
What is the InChIKey of N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The InChIKey is FDMXPQXJEPINHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-3-11(2)8(13)6-4-5-7(12)10-9-6/h3-5H2,1-2H3,(H,10,12).
What are the key properties of N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide has a molecular weight of 183.21 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 43420939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).