C12H19NO2 — CID 43422390
(2E,4E)-1-[3-(hydroxymethyl)piperidin-1-yl]hexa-2,4-dien-1-one (PubChem CID 43422390) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E,4E)-1-[3-(hydroxymethyl)piperidin-1-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[3-(hydroxymethyl)piperidin-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 43422390 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2E,4E)-1-[3-(hydroxymethyl)piperidin-1-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C12H19NO2/c1-2-3-4-7-12(15)13-8-5-6-11(9-13)10-14/h2-4,7,11,14H,5-6,8-10H2,1H3/b3-2+,7-4+ |
| InChIKey | UOBWDJQGRCVWQO-AOGGBPEJSA-N |
| XLogP | 1.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|