About methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate
methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 43422558) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
| PubChem CID | 43422558 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H14N4O3/c1-17-10(16)8-3-2-4-14(8)9(15)5-13-7-11-6-12-13/h6-8H,2-5H2,1H3 |
| InChIKey | UPKHGJNWPRLNGD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate (CID 43422558) is methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate is COC(=O)C1CCCN1C(=O)Cn1cncn1.
What is the InChIKey of methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
The InChIKey is UPKHGJNWPRLNGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O3/c1-17-10(16)8-3-2-4-14(8)9(15)5-13-7-11-6-12-13/h6-8H,2-5H2,1H3.
What are the key properties of methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate?
methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate has a molecular weight of 238.25 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(1,2,4-triazol-1-yl)acetyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 43422558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).