About methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate
methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate (PubChem CID 43422641) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate.
Molecular Properties
| Compound Name | methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate |
| PubChem CID | 43422641 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate |
| SMILES | COC(=O)C(NC(=O)C1=NNC(=O)CC1)C(C)C |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)9(11(17)18-3)12-10(16)7-4-5-8(15)14-13-7/h6,9H,4-5H2,1-3H3,(H,12,16)(H,14,15) |
| InChIKey | XGVYLJQCIVZMFE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate?
The IUPAC name of methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate (CID 43422641) is methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate.
What is the SMILES notation for methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate?
The canonical SMILES for methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate is COC(=O)C(NC(=O)C1=NNC(=O)CC1)C(C)C.
What is the InChIKey of methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate?
The InChIKey is XGVYLJQCIVZMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-6(2)9(11(17)18-3)12-10(16)7-4-5-8(15)14-13-7/h6,9H,4-5H2,1-3H3,(H,12,16)(H,14,15).
What are the key properties of methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate?
methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate has a molecular weight of 255.27 g/mol, XLogP of -0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]butanoate is sourced from PubChem (CID 43422641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).