About methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate
methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate (PubChem CID 43422748) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate.
Molecular Properties
| Compound Name | methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate |
| PubChem CID | 43422748 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C11H18N4O3/c1-8(2)4-9(11(17)18-3)14-10(16)5-15-7-12-6-13-15/h6-9H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | LSNLWTVPOWATAF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate?
The IUPAC name of methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate (CID 43422748) is methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate.
What is the SMILES notation for methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate?
The canonical SMILES for methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate is COC(=O)C(CC(C)C)NC(=O)Cn1cncn1.
What is the InChIKey of methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate?
The InChIKey is LSNLWTVPOWATAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-8(2)4-9(11(17)18-3)14-10(16)5-15-7-12-6-13-15/h6-9H,4-5H2,1-3H3,(H,14,16).
What are the key properties of methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate?
methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate has a molecular weight of 254.29 g/mol, XLogP of -0.02, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]pentanoate is sourced from PubChem (CID 43422748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).