C10H19N3 — CID 43423021
3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide (PubChem CID 43423021) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 43423021 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C10H19N3/c11-10(12)13-7-3-5-8-4-1-2-6-9(8)13/h8-9H,1-7H2,(H3,11,12) |
| InChIKey | KMKYOIGRNIEQIN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|