methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate

C16H18N2O3 — CID 43423135

IUPACmethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate
SMILESCOC(=O)c1ccccc1N(C)C(=O)c1ccc(C)n1C
InChIInChI=1S/C16H18N2O3/c1-11-9-10-14(17(11)2)15(19)18(3)13-8-6-5-7-12(13)16(20)21-4/h5-10H,1-4H3
InChIKeyGCUWVSGIBVSJDO-UHFFFAOYSA-N
MW286.33 g/mol
LogP2.40
Rot. Bonds3

About methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate

methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate (PubChem CID 43423135) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate.

Molecular Properties

Compound Namemethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate
PubChem CID43423135
Molecular FormulaC16H18N2O3
Molecular Weight286.33 g/mol
Exact Mass286.13
IUPAC Namemethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate
SMILESCOC(=O)c1ccccc1N(C)C(=O)c1ccc(C)n1C
InChIInChI=1S/C16H18N2O3/c1-11-9-10-14(17(11)2)15(19)18(3)13-8-6-5-7-12(13)16(20)21-4/h5-10H,1-4H3
InChIKeyGCUWVSGIBVSJDO-UHFFFAOYSA-N
XLogP2.40
TPSA51.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 52.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate?
The IUPAC name of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate (CID 43423135) is methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate.
What is the SMILES notation for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate?
The canonical SMILES for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate is COC(=O)c1ccccc1N(C)C(=O)c1ccc(C)n1C.
What is the InChIKey of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate?
The InChIKey is GCUWVSGIBVSJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-11-9-10-14(17(11)2)15(19)18(3)13-8-6-5-7-12(13)16(20)21-4/h5-10H,1-4H3.
What are the key properties of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate?
methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate has a molecular weight of 286.33 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-methylamino]benzoate is sourced from PubChem (CID 43423135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).