ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate

C11H16F3NO3 — CID 43423506

IUPACethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(C(=O)CC(F)(F)F)CC1
InChIInChI=1S/C11H16F3NO3/c1-2-18-10(17)8-3-5-15(6-4-8)9(16)7-11(12,13)14/h8H,2-7H2,1H3
InChIKeyBVEORYUWIMIDLP-UHFFFAOYSA-N
MW267.25 g/mol
LogP1.74
Rot. Bonds3

About ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate

ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate (PubChem CID 43423506) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate
PubChem CID43423506
Molecular FormulaC11H16F3NO3
Molecular Weight267.25 g/mol
Exact Mass267.11
IUPAC Nameethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(C(=O)CC(F)(F)F)CC1
InChIInChI=1S/C11H16F3NO3/c1-2-18-10(17)8-3-5-15(6-4-8)9(16)7-11(12,13)14/h8H,2-7H2,1H3
InChIKeyBVEORYUWIMIDLP-UHFFFAOYSA-N
XLogP1.74
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.25
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate (CID 43423506) is ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)CC(F)(F)F)CC1.
What is the InChIKey of ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate?
The InChIKey is BVEORYUWIMIDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3NO3/c1-2-18-10(17)8-3-5-15(6-4-8)9(16)7-11(12,13)14/h8H,2-7H2,1H3.
What are the key properties of ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate?
ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate has a molecular weight of 267.25 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxylate is sourced from PubChem (CID 43423506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).