C14H17BrFNO3 — CID 43423763
methyl 2-[(2-bromo-4-fluorobenzoyl)amino]-2-methylpentanoate (PubChem CID 43423763) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is methyl 2-[(2-bromo-4-fluorobenzoyl)amino]-2-methylpentanoate.
| Compound Name | methyl 2-[(2-bromo-4-fluorobenzoyl)amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 43423763 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | methyl 2-[(2-bromo-4-fluorobenzoyl)amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)c1ccc(F)cc1Br)C(=O)OC |
| InChI | InChI=1S/C14H17BrFNO3/c1-4-7-14(2,13(19)20-3)17-12(18)10-6-5-9(16)8-11(10)15/h5-6,8H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | FCERZLXVBOKEBV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |