About methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate
methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 43423844) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate |
| PubChem CID | 43423844 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-4-9(14)11(17)18-2/h6-9H,3-5H2,1-2H3 |
| InChIKey | IYXOLYWHARURFG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate (CID 43423844) is methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate is COC(=O)C1CCCN1C(=O)C(C)n1cncn1.
What is the InChIKey of methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate?
The InChIKey is IYXOLYWHARURFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-8(15-7-12-6-13-15)10(16)14-5-3-4-9(14)11(17)18-2/h6-9H,3-5H2,1-2H3.
What are the key properties of methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate?
methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 0.00, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(1,2,4-triazol-1-yl)propanoyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 43423844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).