About methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate
methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate (PubChem CID 43423874) has the molecular formula C12H20F3NO4
and a molecular weight of 299.29 g/mol. Its IUPAC name is methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate.
Molecular Properties
| Compound Name | methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate |
| PubChem CID | 43423874 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO4/c1-19-11(18)5-3-2-4-7-16-10(17)6-8-20-9-12(13,14)15/h2-9H2,1H3,(H,16,17) |
| InChIKey | XENHBDIXAWUMTB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate?
The IUPAC name of methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate (CID 43423874) is methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate.
What is the SMILES notation for methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate?
The canonical SMILES for methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate is COC(=O)CCCCCNC(=O)CCOCC(F)(F)F.
What is the InChIKey of methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate?
The InChIKey is XENHBDIXAWUMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO4/c1-19-11(18)5-3-2-4-7-16-10(17)6-8-20-9-12(13,14)15/h2-9H2,1H3,(H,16,17).
What are the key properties of methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate?
methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate has a molecular weight of 299.29 g/mol, XLogP of 1.80, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]hexanoate is sourced from PubChem (CID 43423874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).