C14H16BrNS — CID 43426705
1-(3-bromophenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 43426705) has the molecular formula C14H16BrNS and a molecular weight of 310.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 1-(3-bromophenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43426705 |
| Molecular Formula | C14H16BrNS |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 1-(3-bromophenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | Cc1ccsc1CNC(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrNS/c1-10-6-7-17-14(10)9-16-11(2)12-4-3-5-13(15)8-12/h3-8,11,16H,9H2,1-2H3 |
| InChIKey | UAYLTINXROGLTJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |