About 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine
4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine (PubChem CID 43426994) has the molecular formula C7H10ClN3S
and a molecular weight of 203.70 g/mol. Its IUPAC name is 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine |
| PubChem CID | 43426994 |
| Molecular Formula | C7H10ClN3S |
| Molecular Weight | 203.70 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine |
| SMILES | Clc1nsnc1NC1CCCC1 |
| InChI | InChI=1S/C7H10ClN3S/c8-6-7(11-12-10-6)9-5-3-1-2-4-5/h5H,1-4H2,(H,9,11) |
| InChIKey | KYCJFOFQCGTAFR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine?
The IUPAC name of 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine (CID 43426994) is 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine.
What is the SMILES notation for 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine?
The canonical SMILES for 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine is Clc1nsnc1NC1CCCC1.
What is the InChIKey of 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine?
The InChIKey is KYCJFOFQCGTAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3S/c8-6-7(11-12-10-6)9-5-3-1-2-4-5/h5H,1-4H2,(H,9,11).
What are the key properties of 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine?
4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine has a molecular weight of 203.70 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-cyclopentyl-1,2,5-thiadiazol-3-amine is sourced from PubChem (CID 43426994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).