C10H11N3O4 — CID 43427330
6-[[2-(methylamino)-2-oxoethyl]carbamoyl]pyridine-3-carboxylic acid (PubChem CID 43427330) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is 6-[[2-(methylamino)-2-oxoethyl]carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[2-(methylamino)-2-oxoethyl]carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 43427330 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-[[2-(methylamino)-2-oxoethyl]carbamoyl]pyridine-3-carboxylic acid |
| SMILES | CNC(=O)CNC(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H11N3O4/c1-11-8(14)5-13-9(15)7-3-2-6(4-12-7)10(16)17/h2-4H,5H2,1H3,(H,11,14)(H,13,15)(H,16,17) |
| InChIKey | UYMQCRJBECIQLM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |