C9H15ClN2O2S2 — CID 43427518
2-chloro-N,N-dipropyl-1,3-thiazole-5-sulfonamide (PubChem CID 43427518) has the molecular formula C9H15ClN2O2S2 and a molecular weight of 282.82 g/mol. Its IUPAC name is 2-chloro-N,N-dipropyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N,N-dipropyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43427518 |
| Molecular Formula | C9H15ClN2O2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-chloro-N,N-dipropyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H15ClN2O2S2/c1-3-5-12(6-4-2)16(13,14)8-7-11-9(10)15-8/h7H,3-6H2,1-2H3 |
| InChIKey | BFZAKJDJOYDBHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |