C13H21N3 — CID 43428255
4,6-dimethyl-N-(3-methylcyclohexyl)pyrimidin-2-amine (PubChem CID 43428255) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4,6-dimethyl-N-(3-methylcyclohexyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-(3-methylcyclohexyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 43428255 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4,6-dimethyl-N-(3-methylcyclohexyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NC2CCCC(C)C2)n1 |
| InChI | InChI=1S/C13H21N3/c1-9-5-4-6-12(7-9)16-13-14-10(2)8-11(3)15-13/h8-9,12H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | AGIJVJZRKIQTST-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |