C12H21N3O2 — CID 43428596
3-[2-(aminomethyl)cyclohexyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 43428596) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-[2-(aminomethyl)cyclohexyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(aminomethyl)cyclohexyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43428596 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-[2-(aminomethyl)cyclohexyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C2CCCCC2CN)C1=O |
| InChI | InChI=1S/C12H21N3O2/c1-12(2)10(16)15(11(17)14-12)9-6-4-3-5-8(9)7-13/h8-9H,3-7,13H2,1-2H3,(H,14,17) |
| InChIKey | OHTGDKRGUVYWKS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|