C14H25F4NO — CID 43428926
[4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine (PubChem CID 43428926) has the molecular formula C14H25F4NO and a molecular weight of 299.35 g/mol. Its IUPAC name is [4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine.
| Compound Name | [4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 43428926 |
| Molecular Formula | C14H25F4NO |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | [4-tert-butyl-2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]methanamine |
| SMILES | CC(C)(C)C1CCC(CN)C(OCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C14H25F4NO/c1-13(2,3)10-5-4-9(7-19)11(6-10)20-8-14(17,18)12(15)16/h9-12H,4-8,19H2,1-3H3 |
| InChIKey | SXYHLKSMJUIGSR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|