About [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine
[4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine (PubChem CID 43428941) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine |
| PubChem CID | 43428941 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine |
| SMILES | Cc1ccc(C)c(OC2CC(C)CCC2CN)c1C |
| InChI | InChI=1S/C17H27NO/c1-11-5-8-15(10-18)16(9-11)19-17-13(3)7-6-12(2)14(17)4/h6-7,11,15-16H,5,8-10,18H2,1-4H3 |
| InChIKey | VJWVSQFMKZTXHB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine?
The IUPAC name of [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine (CID 43428941) is [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine.
What is the SMILES notation for [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine?
The canonical SMILES for [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine is Cc1ccc(C)c(OC2CC(C)CCC2CN)c1C.
What is the InChIKey of [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine?
The InChIKey is VJWVSQFMKZTXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-11-5-8-15(10-18)16(9-11)19-17-13(3)7-6-12(2)14(17)4/h6-7,11,15-16H,5,8-10,18H2,1-4H3.
What are the key properties of [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine?
[4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine has a molecular weight of 261.41 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-(2,3,6-trimethylphenoxy)cyclohexyl]methanamine is sourced from PubChem (CID 43428941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).