C14H20N2O3 — CID 43429951
1-[3-[2-(hydroxymethyl)piperidin-1-yl]-3-oxopropyl]pyridin-2-one (PubChem CID 43429951) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[3-[2-(hydroxymethyl)piperidin-1-yl]-3-oxopropyl]pyridin-2-one.
| Compound Name | 1-[3-[2-(hydroxymethyl)piperidin-1-yl]-3-oxopropyl]pyridin-2-one |
|---|---|
| PubChem CID | 43429951 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[3-[2-(hydroxymethyl)piperidin-1-yl]-3-oxopropyl]pyridin-2-one |
| SMILES | O=C(CCn1ccccc1=O)N1CCCCC1CO |
| InChI | InChI=1S/C14H20N2O3/c17-11-12-5-1-4-9-16(12)14(19)7-10-15-8-3-2-6-13(15)18/h2-3,6,8,12,17H,1,4-5,7,9-11H2 |
| InChIKey | MZONGJFFGOIAEQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |