About ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate
ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate (PubChem CID 43431161) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate |
| PubChem CID | 43431161 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CCc2nc(C)no2)C1 |
| InChI | InChI=1S/C14H21N3O4/c1-3-20-14(19)11-5-4-8-17(9-11)13(18)7-6-12-15-10(2)16-21-12/h11H,3-9H2,1-2H3 |
| InChIKey | QJCDNQBOIVUQNY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate?
The IUPAC name of ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate (CID 43431161) is ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate is CCOC(=O)C1CCCN(C(=O)CCc2nc(C)no2)C1.
What is the InChIKey of ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate?
The InChIKey is QJCDNQBOIVUQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4/c1-3-20-14(19)11-5-4-8-17(9-11)13(18)7-6-12-15-10(2)16-21-12/h11H,3-9H2,1-2H3.
What are the key properties of ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate?
ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate has a molecular weight of 295.34 g/mol, XLogP of 1.11, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoyl]piperidine-3-carboxylate is sourced from PubChem (CID 43431161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).