About methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate
methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate (PubChem CID 43431338) has the molecular formula C14H19N3O4
and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 43431338 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2c(C)c(C)n[nH]c2=O)CC1 |
| InChI | InChI=1S/C14H19N3O4/c1-8-9(2)15-16-12(18)11(8)13(19)17-6-4-10(5-7-17)14(20)21-3/h10H,4-7H2,1-3H3,(H,16,18) |
| InChIKey | PKZIWUPQZXAXIE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate (CID 43431338) is methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate is COC(=O)C1CCN(C(=O)c2c(C)c(C)n[nH]c2=O)CC1.
What is the InChIKey of methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate?
The InChIKey is PKZIWUPQZXAXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4/c1-8-9(2)15-16-12(18)11(8)13(19)17-6-4-10(5-7-17)14(20)21-3/h10H,4-7H2,1-3H3,(H,16,18).
What are the key properties of methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate?
methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate has a molecular weight of 293.32 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3,4-dimethyl-6-oxo-1H-pyridazine-5-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 43431338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).