C13H19N3O4 — CID 43431552
methyl 4-methyl-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanoate (PubChem CID 43431552) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 4-methyl-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 43431552 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 4-methyl-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C13H19N3O4/c1-9(2)7-10(12(18)20-3)15-11(17)8-16-6-4-5-14-13(16)19/h4-6,9-10H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | LUXKRLBUGRTHBW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |