C6H11N5O4S — CID 43431820
N-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethyl]methanesulfonamide (PubChem CID 43431820) has the molecular formula C6H11N5O4S and a molecular weight of 249.25 g/mol. Its IUPAC name is N-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43431820 |
| Molecular Formula | C6H11N5O4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H11N5O4S/c1-16(14,15)8-3-2-7-4-5(12)9-6(13)11-10-4/h8H,2-3H2,1H3,(H,7,10)(H2,9,11,12,13) |
| InChIKey | YMQRXJLKAAORDD-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|