C11H10ClNO4S3 — CID 43432380
5-[1-(5-chlorothiophen-2-yl)ethylsulfamoyl]thiophene-3-carboxylic acid (PubChem CID 43432380) has the molecular formula C11H10ClNO4S3 and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-[1-(5-chlorothiophen-2-yl)ethylsulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[1-(5-chlorothiophen-2-yl)ethylsulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43432380 |
| Molecular Formula | C11H10ClNO4S3 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 5-[1-(5-chlorothiophen-2-yl)ethylsulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CC(NS(=O)(=O)c1cc(C(=O)O)cs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10ClNO4S3/c1-6(8-2-3-9(12)19-8)13-20(16,17)10-4-7(5-18-10)11(14)15/h2-6,13H,1H3,(H,14,15) |
| InChIKey | MZEMASPQPBTALM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |