C16H16ClN3S — CID 43432658
1-(5-chlorothiophen-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]ethanamine (PubChem CID 43432658) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]ethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43432658 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-[(4-imidazol-1-ylphenyl)methyl]ethanamine |
| SMILES | CC(NCc1ccc(-n2ccnc2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H16ClN3S/c1-12(15-6-7-16(17)21-15)19-10-13-2-4-14(5-3-13)20-9-8-18-11-20/h2-9,11-12,19H,10H2,1H3 |
| InChIKey | FPMPJHLZGYLXCL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |