C10H19N3 — CID 43435289
3-methyl-N-[(2-methylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 43435289) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-methyl-N-[(2-methylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | 3-methyl-N-[(2-methylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 43435289 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-methyl-N-[(2-methylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | CC(C)CCNCc1ccnn1C |
| InChI | InChI=1S/C10H19N3/c1-9(2)4-6-11-8-10-5-7-12-13(10)3/h5,7,9,11H,4,6,8H2,1-3H3 |
| InChIKey | SJOFFSXJROBNTC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|