About N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43435516) has the molecular formula C17H27N3
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 43435516 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Cc1c(C(C)NC2CC3CC2C2CCCC32)cnn1C |
| InChI | InChI=1S/C17H27N3/c1-10(16-9-18-20(3)11(16)2)19-17-8-12-7-15(17)14-6-4-5-13(12)14/h9-10,12-15,17,19H,4-8H2,1-3H3 |
| InChIKey | DSMKGPVMVNCRIP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine (CID 43435516) is N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine is Cc1c(C(C)NC2CC3CC2C2CCCC32)cnn1C.
What is the InChIKey of N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is DSMKGPVMVNCRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3/c1-10(16-9-18-20(3)11(16)2)19-17-8-12-7-15(17)14-6-4-5-13(12)14/h9-10,12-15,17,19H,4-8H2,1-3H3.
What are the key properties of N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine?
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 273.42 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 43435516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).