2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid

C14H21NO4 — CID 43437145

IUPAC2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)N1C(=O)CC2(CCCC2)C1=O
InChIInChI=1S/C14H21NO4/c1-9(2)7-10(12(17)18)15-11(16)8-14(13(15)19)5-3-4-6-14/h9-10H,3-8H2,1-2H3,(H,17,18)
InChIKeyALQCITFFOOLFJS-UHFFFAOYSA-N
MW267.32 g/mol
LogP1.80
Rot. Bonds4

About 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid

2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid (PubChem CID 43437145) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid
PubChem CID43437145
Molecular FormulaC14H21NO4
Molecular Weight267.32 g/mol
Exact Mass267.15
IUPAC Name2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid
SMILESCC(C)CC(C(=O)O)N1C(=O)CC2(CCCC2)C1=O
InChIInChI=1S/C14H21NO4/c1-9(2)7-10(12(17)18)15-11(16)8-14(13(15)19)5-3-4-6-14/h9-10H,3-8H2,1-2H3,(H,17,18)
InChIKeyALQCITFFOOLFJS-UHFFFAOYSA-N
XLogP1.80
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.32
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid?
The IUPAC name of 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid (CID 43437145) is 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid.
What is the SMILES notation for 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid?
The canonical SMILES for 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid is CC(C)CC(C(=O)O)N1C(=O)CC2(CCCC2)C1=O.
What is the InChIKey of 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid?
The InChIKey is ALQCITFFOOLFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-9(2)7-10(12(17)18)15-11(16)8-14(13(15)19)5-3-4-6-14/h9-10H,3-8H2,1-2H3,(H,17,18).
What are the key properties of 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid?
2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid has a molecular weight of 267.32 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-4-methylpentanoic acid is sourced from PubChem (CID 43437145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).