C14H27NO3 — CID 43437391
4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid (PubChem CID 43437391) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43437391 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCCN(CCC)C(=O)CC(CC)(CC)C(=O)O |
| InChI | InChI=1S/C14H27NO3/c1-5-9-15(10-6-2)12(16)11-14(7-3,8-4)13(17)18/h5-11H2,1-4H3,(H,17,18) |
| InChIKey | LGFGOVVPRFJCQW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |