4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid

C14H27NO3 — CID 43437391

IUPAC4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid
SMILESCCCN(CCC)C(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C14H27NO3/c1-5-9-15(10-6-2)12(16)11-14(7-3,8-4)13(17)18/h5-11H2,1-4H3,(H,17,18)
InChIKeyLGFGOVVPRFJCQW-UHFFFAOYSA-N
MW257.37 g/mol
LogP2.92
Rot. Bonds9

About 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid

4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid (PubChem CID 43437391) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid
PubChem CID43437391
Molecular FormulaC14H27NO3
Molecular Weight257.37 g/mol
Exact Mass257.20
IUPAC Name4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid
SMILESCCCN(CCC)C(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C14H27NO3/c1-5-9-15(10-6-2)12(16)11-14(7-3,8-4)13(17)18/h5-11H2,1-4H3,(H,17,18)
InChIKeyLGFGOVVPRFJCQW-UHFFFAOYSA-N
XLogP2.92
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.37
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid?
The IUPAC name of 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid (CID 43437391) is 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid is CCCN(CCC)C(=O)CC(CC)(CC)C(=O)O.
What is the InChIKey of 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid?
The InChIKey is LGFGOVVPRFJCQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-5-9-15(10-6-2)12(16)11-14(7-3,8-4)13(17)18/h5-11H2,1-4H3,(H,17,18).
What are the key properties of 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid?
4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid has a molecular weight of 257.37 g/mol, XLogP of 2.92, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dipropylamino)-2,2-diethyl-4-oxobutanoic acid is sourced from PubChem (CID 43437391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).