C10H14ClNO2S — CID 43439202
methyl 3-[1-(5-chlorothiophen-2-yl)ethylamino]propanoate (PubChem CID 43439202) has the molecular formula C10H14ClNO2S and a molecular weight of 247.75 g/mol. Its IUPAC name is methyl 3-[1-(5-chlorothiophen-2-yl)ethylamino]propanoate.
| Compound Name | methyl 3-[1-(5-chlorothiophen-2-yl)ethylamino]propanoate |
|---|---|
| PubChem CID | 43439202 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | methyl 3-[1-(5-chlorothiophen-2-yl)ethylamino]propanoate |
| SMILES | COC(=O)CCNC(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO2S/c1-7(8-3-4-9(11)15-8)12-6-5-10(13)14-2/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | DQNULAHTCCSUSQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |