C13H13N3S — CID 43439683
5-methyl-N-quinolin-8-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43439683) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 5-methyl-N-quinolin-8-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-methyl-N-quinolin-8-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43439683 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 5-methyl-N-quinolin-8-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC1CN=C(Nc2cccc3cccnc23)S1 |
| InChI | InChI=1S/C13H13N3S/c1-9-8-15-13(17-9)16-11-6-2-4-10-5-3-7-14-12(10)11/h2-7,9H,8H2,1H3,(H,15,16) |
| InChIKey | MLZKMAYEVRBDOU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |