About 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine
5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43439784) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 43439784 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCCNC1=NCC(C)S1 |
| InChI | InChI=1S/C9H18N2S/c1-3-4-5-6-10-9-11-7-8(2)12-9/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | UUTTYHCIPFMIEU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine (CID 43439784) is 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine is CCCCCNC1=NCC(C)S1.
What is the InChIKey of 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is UUTTYHCIPFMIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-3-4-5-6-10-9-11-7-8(2)12-9/h8H,3-7H2,1-2H3,(H,10,11).
What are the key properties of 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine?
5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 186.32 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-pentyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 43439784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).