About 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol
2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol (PubChem CID 43440302) has the molecular formula C13H18FNO4S
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol |
| PubChem CID | 43440302 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol |
| SMILES | O=S1(=O)CCC(NCCOCCO)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H18FNO4S/c14-10-1-2-13-11(9-10)12(3-8-20(13,17)18)15-4-6-19-7-5-16/h1-2,9,12,15-16H,3-8H2 |
| InChIKey | WPZUCADPDNTJQD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol?
The IUPAC name of 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol (CID 43440302) is 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol?
The canonical SMILES for 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol is O=S1(=O)CCC(NCCOCCO)c2cc(F)ccc21.
What is the InChIKey of 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol?
The InChIKey is WPZUCADPDNTJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO4S/c14-10-1-2-13-11(9-10)12(3-8-20(13,17)18)15-4-6-19-7-5-16/h1-2,9,12,15-16H,3-8H2.
What are the key properties of 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol?
2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol has a molecular weight of 303.36 g/mol, XLogP of 0.64, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl)amino]ethoxy]ethanol is sourced from PubChem (CID 43440302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).