About 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid
3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 43443066) has the molecular formula C9H11NO6S3
and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid |
| PubChem CID | 43443066 |
| Molecular Formula | C9H11NO6S3 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1NS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H11NO6S3/c11-9(12)8-7(1-3-17-8)10-19(15,16)6-2-4-18(13,14)5-6/h1,3,6,10H,2,4-5H2,(H,11,12) |
| InChIKey | NQJISXUSCBOLEB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid (CID 43443066) is 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid is O=C(O)c1sccc1NS(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid?
The InChIKey is NQJISXUSCBOLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO6S3/c11-9(12)8-7(1-3-17-8)10-19(15,16)6-2-4-18(13,14)5-6/h1,3,6,10H,2,4-5H2,(H,11,12).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid?
3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid has a molecular weight of 325.39 g/mol, XLogP of 0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)sulfonylamino]thiophene-2-carboxylic acid is sourced from PubChem (CID 43443066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).