About 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid
2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid (PubChem CID 43443198) has the molecular formula C11H12FNO4S
and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid |
| PubChem CID | 43443198 |
| Molecular Formula | C11H12FNO4S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H12FNO4S/c12-8-2-1-3-9(10(8)11(14)15)13-4-6-18(16,17)7-5-13/h1-3H,4-7H2,(H,14,15) |
| InChIKey | ULGUKWIHRWEHAU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid?
The IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid (CID 43443198) is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid.
What is the SMILES notation for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid?
The canonical SMILES for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid is O=C(O)c1c(F)cccc1N1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid?
The InChIKey is ULGUKWIHRWEHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO4S/c12-8-2-1-3-9(10(8)11(14)15)13-4-6-18(16,17)7-5-13/h1-3H,4-7H2,(H,14,15).
What are the key properties of 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid?
2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid has a molecular weight of 273.28 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,4-thiazinan-4-yl)-6-fluorobenzoic acid is sourced from PubChem (CID 43443198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).