About 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide
1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide (PubChem CID 43443220) has the molecular formula C12H22N4O3S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
| PubChem CID | 43443220 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
| SMILES | Cc1cc(CS(=O)(=O)NCCCN2CCNCC2)no1 |
| InChI | InChI=1S/C12H22N4O3S/c1-11-9-12(15-19-11)10-20(17,18)14-3-2-6-16-7-4-13-5-8-16/h9,13-14H,2-8,10H2,1H3 |
| InChIKey | YYPQGIJDGOWTQS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide?
The IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide (CID 43443220) is 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide.
What is the SMILES notation for 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide?
The canonical SMILES for 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide is Cc1cc(CS(=O)(=O)NCCCN2CCNCC2)no1.
What is the InChIKey of 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide?
The InChIKey is YYPQGIJDGOWTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O3S/c1-11-9-12(15-19-11)10-20(17,18)14-3-2-6-16-7-4-13-5-8-16/h9,13-14H,2-8,10H2,1H3.
What are the key properties of 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide?
1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide has a molecular weight of 302.40 g/mol, XLogP of -0.30, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,2-oxazol-3-yl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide is sourced from PubChem (CID 43443220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).