About 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid
2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid (PubChem CID 43444914) has the molecular formula C6H6N2O4
and a molecular weight of 170.12 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid |
| PubChem CID | 43444914 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)on1 |
| InChI | InChI=1S/C6H6N2O4/c1-3-2-4(12-8-3)7-5(9)6(10)11/h2H,1H3,(H,7,9)(H,10,11) |
| InChIKey | WFTNSXUCBQFGQP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid?
The IUPAC name of 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid (CID 43444914) is 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid.
What is the SMILES notation for 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid?
The canonical SMILES for 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid is Cc1cc(NC(=O)C(=O)O)on1.
What is the InChIKey of 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid?
The InChIKey is WFTNSXUCBQFGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c1-3-2-4(12-8-3)7-5(9)6(10)11/h2H,1H3,(H,7,9)(H,10,11).
What are the key properties of 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid?
2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid has a molecular weight of 170.12 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-1,2-oxazol-5-yl)amino]-2-oxoacetic acid is sourced from PubChem (CID 43444914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).