About 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide
2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 43445240) has the molecular formula C9H11N5OS
and a molecular weight of 237.29 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 43445240 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(NC(=O)Cn2cc(N)cn2)n1 |
| InChI | InChI=1S/C9H11N5OS/c1-6-5-16-9(12-6)13-8(15)4-14-3-7(10)2-11-14/h2-3,5H,4,10H2,1H3,(H,12,13,15) |
| InChIKey | DNMVHTNHAAHAKA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (CID 43445240) is 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide is Cc1csc(NC(=O)Cn2cc(N)cn2)n1.
What is the InChIKey of 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is DNMVHTNHAAHAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5OS/c1-6-5-16-9(12-6)13-8(15)4-14-3-7(10)2-11-14/h2-3,5H,4,10H2,1H3,(H,12,13,15).
What are the key properties of 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide?
2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 237.29 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminopyrazol-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 43445240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).