About 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid
2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid (PubChem CID 43445732) has the molecular formula C5H6N4O3S
and a molecular weight of 202.19 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid |
| PubChem CID | 43445732 |
| Molecular Formula | C5H6N4O3S |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid |
| SMILES | O=C(O)CNC(=O)Nc1nncs1 |
| InChI | InChI=1S/C5H6N4O3S/c10-3(11)1-6-4(12)8-5-9-7-2-13-5/h2H,1H2,(H,10,11)(H2,6,8,9,12) |
| InChIKey | SFKVQICHSKLPGU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid?
The IUPAC name of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid (CID 43445732) is 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid.
What is the SMILES notation for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid?
The canonical SMILES for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid is O=C(O)CNC(=O)Nc1nncs1.
What is the InChIKey of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid?
The InChIKey is SFKVQICHSKLPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O3S/c10-3(11)1-6-4(12)8-5-9-7-2-13-5/h2H,1H2,(H,10,11)(H2,6,8,9,12).
What are the key properties of 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid?
2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid has a molecular weight of 202.19 g/mol, XLogP of -0.26, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4-thiadiazol-2-ylcarbamoylamino)acetic acid is sourced from PubChem (CID 43445732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).