C14H22N2O3S — CID 43446037
N-(5-amino-2-methoxyphenyl)-4-(2-methoxyethylsulfanyl)butanamide (PubChem CID 43446037) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-(5-amino-2-methoxyphenyl)-4-(2-methoxyethylsulfanyl)butanamide.
| Compound Name | N-(5-amino-2-methoxyphenyl)-4-(2-methoxyethylsulfanyl)butanamide |
|---|---|
| PubChem CID | 43446037 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(5-amino-2-methoxyphenyl)-4-(2-methoxyethylsulfanyl)butanamide |
| SMILES | COCCSCCCC(=O)Nc1cc(N)ccc1OC |
| InChI | InChI=1S/C14H22N2O3S/c1-18-7-9-20-8-3-4-14(17)16-12-10-11(15)5-6-13(12)19-2/h5-6,10H,3-4,7-9,15H2,1-2H3,(H,16,17) |
| InChIKey | CEQRWMVRFHLJTH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|