About 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide
2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide (PubChem CID 43446649) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide |
| PubChem CID | 43446649 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)CN1C(=O)CCCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H19N3O2/c1-2-16-13(18)9-17-12-7-6-11(15)8-10(12)4-3-5-14(17)19/h6-8H,2-5,9,15H2,1H3,(H,16,18) |
| InChIKey | URYMKDYQMPVFDT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide?
The IUPAC name of 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide (CID 43446649) is 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide.
What is the SMILES notation for 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide?
The canonical SMILES for 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide is CCNC(=O)CN1C(=O)CCCc2cc(N)ccc21.
What is the InChIKey of 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide?
The InChIKey is URYMKDYQMPVFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-2-16-13(18)9-17-12-7-6-11(15)8-10(12)4-3-5-14(17)19/h6-8H,2-5,9,15H2,1H3,(H,16,18).
What are the key properties of 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide?
2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide has a molecular weight of 261.32 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)-N-ethylacetamide is sourced from PubChem (CID 43446649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).