C13H12ClNO4 — CID 43446726
4-chloro-3-(2,7-dioxoazepan-1-yl)benzoic acid (PubChem CID 43446726) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is 4-chloro-3-(2,7-dioxoazepan-1-yl)benzoic acid.
| Compound Name | 4-chloro-3-(2,7-dioxoazepan-1-yl)benzoic acid |
|---|---|
| PubChem CID | 43446726 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-chloro-3-(2,7-dioxoazepan-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(N2C(=O)CCCCC2=O)c1 |
| InChI | InChI=1S/C13H12ClNO4/c14-9-6-5-8(13(18)19)7-10(9)15-11(16)3-1-2-4-12(15)17/h5-7H,1-4H2,(H,18,19) |
| InChIKey | LVCWLNGUDUALQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|